C35H47N3O5 — CID 69445755
1-[3-[4-[6-[[(2R)-2-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)-2-hydroxyethyl]amino]hexoxy]butyl]phenyl]-3-phenylurea (PubChem CID 69445755) has the molecular formula C35H47N3O5 and a molecular weight of 589.78 g/mol. Its IUPAC name is 1-[3-[4-[6-[[(2R)-2-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)-2-hydroxyethyl]amino]hexoxy]butyl]phenyl]-3-phenylurea.
| Compound Name | 1-[3-[4-[6-[[(2R)-2-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)-2-hydroxyethyl]amino]hexoxy]butyl]phenyl]-3-phenylurea |
|---|---|
| PubChem CID | 69445755 |
| Molecular Formula | C35H47N3O5 |
| Molecular Weight | 589.78 g/mol |
| Exact Mass | 589.35 |
| IUPAC Name | 1-[3-[4-[6-[[(2R)-2-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)-2-hydroxyethyl]amino]hexoxy]butyl]phenyl]-3-phenylurea |
| SMILES | CC1(C)OCc2cc([C@@H](O)CNCCCCCCOCCCCc3cccc(NC(=O)Nc4ccccc4)c3)ccc2O1 |
| InChI | InChI=1S/C35H47N3O5/c1-35(2)42-26-29-24-28(18-19-33(29)43-35)32(39)25-36-20-9-3-4-10-21-41-22-11-8-13-27-14-12-17-31(23-27)38-34(40)37-30-15-6-5-7-16-30/h5-7,12,14-19,23-24,32,36,39H,3-4,8-11,13,20-22,25-26H2,1-2H3,(H2,37,38,40)/t32-/m0/s1 |
| InChIKey | OYLJDPVVZSQVFU-YTTGMZPUSA-N |
| XLogP | 7.20 |
| TPSA | 101.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.78 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|