C30H42N4O6 — CID 69344113
4-[3-[4-[6-[[(2S)-2-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)-2-hydroxyethyl]amino]hexoxy]butyl]phenyl]-1,2,4-triazolidine-3,5-dione (PubChem CID 69344113) has the molecular formula C30H42N4O6 and a molecular weight of 554.69 g/mol. Its IUPAC name is 4-[3-[4-[6-[[(2S)-2-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)-2-hydroxyethyl]amino]hexoxy]butyl]phenyl]-1,2,4-triazolidine-3,5-dione.
| Compound Name | 4-[3-[4-[6-[[(2S)-2-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)-2-hydroxyethyl]amino]hexoxy]butyl]phenyl]-1,2,4-triazolidine-3,5-dione |
|---|---|
| PubChem CID | 69344113 |
| Molecular Formula | C30H42N4O6 |
| Molecular Weight | 554.69 g/mol |
| Exact Mass | 554.31 |
| IUPAC Name | 4-[3-[4-[6-[[(2S)-2-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)-2-hydroxyethyl]amino]hexoxy]butyl]phenyl]-1,2,4-triazolidine-3,5-dione |
| SMILES | CC1(C)OCc2cc([C@H](O)CNCCCCCCOCCCCc3cccc(-n4c(=O)[nH][nH]c4=O)c3)ccc2O1 |
| InChI | InChI=1S/C30H42N4O6/c1-30(2)39-21-24-19-23(13-14-27(24)40-30)26(35)20-31-15-6-3-4-7-16-38-17-8-5-10-22-11-9-12-25(18-22)34-28(36)32-33-29(34)37/h9,11-14,18-19,26,31,35H,3-8,10,15-17,20-21H2,1-2H3,(H,32,36)(H,33,37)/t26-/m1/s1 |
| InChIKey | YYFXZUFIHGTKRZ-AREMUKBSSA-N |
| XLogP | 3.72 |
| TPSA | 130.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.69 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|