C27H39NO5 — CID 46833993
(1R)-1-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)-2-[6-(2-phenylmethoxyethoxy)hexylamino]ethanol (PubChem CID 46833993) has the molecular formula C27H39NO5 and a molecular weight of 457.61 g/mol. Its IUPAC name is (1R)-1-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)-2-[6-(2-phenylmethoxyethoxy)hexylamino]ethanol.
| Compound Name | (1R)-1-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)-2-[6-(2-phenylmethoxyethoxy)hexylamino]ethanol |
|---|---|
| PubChem CID | 46833993 |
| Molecular Formula | C27H39NO5 |
| Molecular Weight | 457.61 g/mol |
| Exact Mass | 457.28 |
| IUPAC Name | (1R)-1-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)-2-[6-(2-phenylmethoxyethoxy)hexylamino]ethanol |
| SMILES | CC1(C)OCc2cc([C@@H](O)CNCCCCCCOCCOCc3ccccc3)ccc2O1 |
| InChI | InChI=1S/C27H39NO5/c1-27(2)32-21-24-18-23(12-13-26(24)33-27)25(29)19-28-14-8-3-4-9-15-30-16-17-31-20-22-10-6-5-7-11-22/h5-7,10-13,18,25,28-29H,3-4,8-9,14-17,19-21H2,1-2H3/t25-/m0/s1 |
| InChIKey | IMKKLTARPKKAMK-VWLOTQADSA-N |
| XLogP | 4.75 |
| TPSA | 69.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.61 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|