C28H40N2O6 — CID 67453370
benzyl-[2-[6-[[2-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)-2-hydroxyethyl]amino]hexoxy]ethyl]carbamic acid (PubChem CID 67453370) has the molecular formula C28H40N2O6 and a molecular weight of 500.64 g/mol. Its IUPAC name is benzyl-[2-[6-[[2-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)-2-hydroxyethyl]amino]hexoxy]ethyl]carbamic acid.
| Compound Name | benzyl-[2-[6-[[2-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)-2-hydroxyethyl]amino]hexoxy]ethyl]carbamic acid |
|---|---|
| PubChem CID | 67453370 |
| Molecular Formula | C28H40N2O6 |
| Molecular Weight | 500.64 g/mol |
| Exact Mass | 500.29 |
| IUPAC Name | benzyl-[2-[6-[[2-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)-2-hydroxyethyl]amino]hexoxy]ethyl]carbamic acid |
| SMILES | CC1(C)OCc2cc(C(O)CNCCCCCCOCCN(Cc3ccccc3)C(=O)O)ccc2O1 |
| InChI | InChI=1S/C28H40N2O6/c1-28(2)35-21-24-18-23(12-13-26(24)36-28)25(31)19-29-14-8-3-4-9-16-34-17-15-30(27(32)33)20-22-10-6-5-7-11-22/h5-7,10-13,18,25,29,31H,3-4,8-9,14-17,19-21H2,1-2H3,(H,32,33) |
| InChIKey | JZPLZDALPSFGEU-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 100.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.64 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|