C34H44N2O5 — CID 88511834
N-[4-[2-[6-[benzyl-[2-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)-2-hydroxyethyl]amino]hexoxy]ethyl]phenyl]formamide (PubChem CID 88511834) has the molecular formula C34H44N2O5 and a molecular weight of 560.74 g/mol. Its IUPAC name is N-[4-[2-[6-[benzyl-[2-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)-2-hydroxyethyl]amino]hexoxy]ethyl]phenyl]formamide.
| Compound Name | N-[4-[2-[6-[benzyl-[2-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)-2-hydroxyethyl]amino]hexoxy]ethyl]phenyl]formamide |
|---|---|
| PubChem CID | 88511834 |
| Molecular Formula | C34H44N2O5 |
| Molecular Weight | 560.74 g/mol |
| Exact Mass | 560.33 |
| IUPAC Name | N-[4-[2-[6-[benzyl-[2-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)-2-hydroxyethyl]amino]hexoxy]ethyl]phenyl]formamide |
| SMILES | CC1(C)OCc2cc(C(O)CN(CCCCCCOCCc3ccc(NC=O)cc3)Cc3ccccc3)ccc2O1 |
| InChI | InChI=1S/C34H44N2O5/c1-34(2)40-25-30-22-29(14-17-33(30)41-34)32(38)24-36(23-28-10-6-5-7-11-28)19-8-3-4-9-20-39-21-18-27-12-15-31(16-13-27)35-26-37/h5-7,10-17,22,26,32,38H,3-4,8-9,18-21,23-25H2,1-2H3,(H,35,37) |
| InChIKey | GMUDEABQALFSMR-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 80.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.74 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|