C32H43NO4 — CID 70494971
4-[2-[benzyl-[6-(3-phenylpropoxy)hexyl]amino]-1-hydroxyethyl]-2-(1-hydroxyethyl)phenol (PubChem CID 70494971) has the molecular formula C32H43NO4 and a molecular weight of 505.70 g/mol. Its IUPAC name is 4-[2-[benzyl-[6-(3-phenylpropoxy)hexyl]amino]-1-hydroxyethyl]-2-(1-hydroxyethyl)phenol.
| Compound Name | 4-[2-[benzyl-[6-(3-phenylpropoxy)hexyl]amino]-1-hydroxyethyl]-2-(1-hydroxyethyl)phenol |
|---|---|
| PubChem CID | 70494971 |
| Molecular Formula | C32H43NO4 |
| Molecular Weight | 505.70 g/mol |
| Exact Mass | 505.32 |
| IUPAC Name | 4-[2-[benzyl-[6-(3-phenylpropoxy)hexyl]amino]-1-hydroxyethyl]-2-(1-hydroxyethyl)phenol |
| SMILES | CC(O)c1cc(C(O)CN(CCCCCCOCCCc2ccccc2)Cc2ccccc2)ccc1O |
| InChI | InChI=1S/C32H43NO4/c1-26(34)30-23-29(18-19-31(30)35)32(36)25-33(24-28-15-8-5-9-16-28)20-10-2-3-11-21-37-22-12-17-27-13-6-4-7-14-27/h4-9,13-16,18-19,23,26,32,34-36H,2-3,10-12,17,20-22,24-25H2,1H3 |
| InChIKey | VPRVOJFQQLJJTH-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.70 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|