C32H45NO4 — CID 131974290
4-[2-[benzyl-[6-(4-cyclohexa-1,5-dien-1-ylbutoxy)hexyl]amino]-1-hydroxyethyl]-2-(hydroxymethyl)phenol (PubChem CID 131974290) has the molecular formula C32H45NO4 and a molecular weight of 507.72 g/mol. Its IUPAC name is 4-[2-[benzyl-[6-(4-cyclohexa-1,5-dien-1-ylbutoxy)hexyl]amino]-1-hydroxyethyl]-2-(hydroxymethyl)phenol.
| Compound Name | 4-[2-[benzyl-[6-(4-cyclohexa-1,5-dien-1-ylbutoxy)hexyl]amino]-1-hydroxyethyl]-2-(hydroxymethyl)phenol |
|---|---|
| PubChem CID | 131974290 |
| Molecular Formula | C32H45NO4 |
| Molecular Weight | 507.72 g/mol |
| Exact Mass | 507.33 |
| IUPAC Name | 4-[2-[benzyl-[6-(4-cyclohexa-1,5-dien-1-ylbutoxy)hexyl]amino]-1-hydroxyethyl]-2-(hydroxymethyl)phenol |
| SMILES | OCc1cc(C(O)CN(CCCCCCOCCCCC2=CCCC=C2)Cc2ccccc2)ccc1O |
| InChI | InChI=1S/C32H45NO4/c34-26-30-23-29(18-19-31(30)35)32(36)25-33(24-28-16-7-4-8-17-28)20-10-1-2-11-21-37-22-12-9-15-27-13-5-3-6-14-27/h4-5,7-8,13-14,16-19,23,32,34-36H,1-3,6,9-12,15,20-22,24-26H2 |
| InChIKey | QLQXVRDJKKNDSV-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.72 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|