C32H44N2O6S — CID 69201211
3-[3-[7-[benzyl-[(2R)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]heptoxy]propyl]benzenesulfonamide (PubChem CID 69201211) has the molecular formula C32H44N2O6S and a molecular weight of 584.78 g/mol. Its IUPAC name is 3-[3-[7-[benzyl-[(2R)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]heptoxy]propyl]benzenesulfonamide.
| Compound Name | 3-[3-[7-[benzyl-[(2R)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]heptoxy]propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 69201211 |
| Molecular Formula | C32H44N2O6S |
| Molecular Weight | 584.78 g/mol |
| Exact Mass | 584.29 |
| IUPAC Name | 3-[3-[7-[benzyl-[(2R)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]heptoxy]propyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cccc(CCCOCCCCCCCN(Cc2ccccc2)C[C@H](O)c2ccc(O)c(CO)c2)c1 |
| InChI | InChI=1S/C32H44N2O6S/c33-41(38,39)30-15-9-13-26(21-30)14-10-20-40-19-8-3-1-2-7-18-34(23-27-11-5-4-6-12-27)24-32(37)28-16-17-31(36)29(22-28)25-35/h4-6,9,11-13,15-17,21-22,32,35-37H,1-3,7-8,10,14,18-20,23-25H2,(H2,33,38,39)/t32-/m0/s1 |
| InChIKey | WIAOEEOYFXHKQE-YTTGMZPUSA-N |
| XLogP | 4.67 |
| TPSA | 133.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.78 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|