C40H52N2O5S — CID 19862674
N-[[5-[2-[benzyl-[6-(4-phenylbutoxy)hexyl]amino]-1-hydroxyethyl]-2-phenylmethoxyphenyl]methyl]methanesulfonamide (PubChem CID 19862674) has the molecular formula C40H52N2O5S and a molecular weight of 672.93 g/mol. Its IUPAC name is N-[[5-[2-[benzyl-[6-(4-phenylbutoxy)hexyl]amino]-1-hydroxyethyl]-2-phenylmethoxyphenyl]methyl]methanesulfonamide.
| Compound Name | N-[[5-[2-[benzyl-[6-(4-phenylbutoxy)hexyl]amino]-1-hydroxyethyl]-2-phenylmethoxyphenyl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 19862674 |
| Molecular Formula | C40H52N2O5S |
| Molecular Weight | 672.93 g/mol |
| Exact Mass | 672.36 |
| IUPAC Name | N-[[5-[2-[benzyl-[6-(4-phenylbutoxy)hexyl]amino]-1-hydroxyethyl]-2-phenylmethoxyphenyl]methyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCc1cc(C(O)CN(CCCCCCOCCCCc2ccccc2)Cc2ccccc2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C40H52N2O5S/c1-48(44,45)41-30-38-29-37(24-25-40(38)47-33-36-22-11-6-12-23-36)39(43)32-42(31-35-20-9-5-10-21-35)26-14-2-3-15-27-46-28-16-13-19-34-17-7-4-8-18-34/h4-12,17-18,20-25,29,39,41,43H,2-3,13-16,19,26-28,30-33H2,1H3 |
| InChIKey | HKSYSDQCPAOPRF-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.93 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|