C47H50N2O6 — CID 158348022
4-[2-(benzylamino)ethyl]phenol;methyl 5-[2-[benzyl-[2-(4-hydroxyphenyl)ethyl]amino]-1-hydroxyethyl]-2-phenylmethoxybenzoate (PubChem CID 158348022) has the molecular formula C47H50N2O6 and a molecular weight of 738.93 g/mol. Its IUPAC name is 4-[2-(benzylamino)ethyl]phenol;methyl 5-[2-[benzyl-[2-(4-hydroxyphenyl)ethyl]amino]-1-hydroxyethyl]-2-phenylmethoxybenzoate.
| Compound Name | 4-[2-(benzylamino)ethyl]phenol;methyl 5-[2-[benzyl-[2-(4-hydroxyphenyl)ethyl]amino]-1-hydroxyethyl]-2-phenylmethoxybenzoate |
|---|---|
| PubChem CID | 158348022 |
| Molecular Formula | C47H50N2O6 |
| Molecular Weight | 738.93 g/mol |
| Exact Mass | 738.37 |
| IUPAC Name | 4-[2-(benzylamino)ethyl]phenol;methyl 5-[2-[benzyl-[2-(4-hydroxyphenyl)ethyl]amino]-1-hydroxyethyl]-2-phenylmethoxybenzoate |
| SMILES | COC(=O)c1cc(C(O)CN(CCc2ccc(O)cc2)Cc2ccccc2)ccc1OCc1ccccc1.Oc1ccc(CCNCc2ccccc2)cc1 |
| InChI | InChI=1S/C32H33NO5.C15H17NO/c1-37-32(36)29-20-27(14-17-31(29)38-23-26-10-6-3-7-11-26)30(35)22-33(21-25-8-4-2-5-9-25)19-18-24-12-15-28(34)16-13-24;17-15-8-6-13(7-9-15)10-11-16-12-14-4-2-1-3-5-14/h2-17,20,30,34-35H,18-19,21-23H2,1H3;1-9,16-17H,10-12H2 |
| InChIKey | GRYZPLPCRKFYMK-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 111.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.93 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|