C37H38N4O3 — CID 139775613
2-[4-[2-[[2-(3-amino-4-phenylmethoxyphenyl)-2-hydroxyethyl]-benzylamino]ethyl]-2-pyridinyl]-N-phenylacetamide (PubChem CID 139775613) has the molecular formula C37H38N4O3 and a molecular weight of 586.74 g/mol. Its IUPAC name is 2-[4-[2-[[2-(3-amino-4-phenylmethoxyphenyl)-2-hydroxyethyl]-benzylamino]ethyl]-2-pyridinyl]-N-phenylacetamide.
| Compound Name | 2-[4-[2-[[2-(3-amino-4-phenylmethoxyphenyl)-2-hydroxyethyl]-benzylamino]ethyl]-2-pyridinyl]-N-phenylacetamide |
|---|---|
| PubChem CID | 139775613 |
| Molecular Formula | C37H38N4O3 |
| Molecular Weight | 586.74 g/mol |
| Exact Mass | 586.29 |
| IUPAC Name | 2-[4-[2-[[2-(3-amino-4-phenylmethoxyphenyl)-2-hydroxyethyl]-benzylamino]ethyl]-2-pyridinyl]-N-phenylacetamide |
| SMILES | Nc1cc(C(O)CN(CCc2ccnc(CC(=O)Nc3ccccc3)c2)Cc2ccccc2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C37H38N4O3/c38-34-23-31(16-17-36(34)44-27-30-12-6-2-7-13-30)35(42)26-41(25-29-10-4-1-5-11-29)21-19-28-18-20-39-33(22-28)24-37(43)40-32-14-8-3-9-15-32/h1-18,20,22-23,35,42H,19,21,24-27,38H2,(H,40,43) |
| InChIKey | XIIDYFSJVAFWSG-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 100.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.74 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|