C36H34ClN3O5S — CID 87968113
5-[4-[2-[benzyl-[(2S)-2-(6-chloro-3-pyridinyl)-2-hydroxyethyl]amino]ethyl]phenyl]sulfonyl-2-phenylmethoxybenzamide (PubChem CID 87968113) has the molecular formula C36H34ClN3O5S and a molecular weight of 656.20 g/mol. Its IUPAC name is 5-[4-[2-[benzyl-[(2S)-2-(6-chloro-3-pyridinyl)-2-hydroxyethyl]amino]ethyl]phenyl]sulfonyl-2-phenylmethoxybenzamide.
| Compound Name | 5-[4-[2-[benzyl-[(2S)-2-(6-chloro-3-pyridinyl)-2-hydroxyethyl]amino]ethyl]phenyl]sulfonyl-2-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 87968113 |
| Molecular Formula | C36H34ClN3O5S |
| Molecular Weight | 656.20 g/mol |
| Exact Mass | 655.19 |
| IUPAC Name | 5-[4-[2-[benzyl-[(2S)-2-(6-chloro-3-pyridinyl)-2-hydroxyethyl]amino]ethyl]phenyl]sulfonyl-2-phenylmethoxybenzamide |
| SMILES | NC(=O)c1cc(S(=O)(=O)c2ccc(CCN(Cc3ccccc3)C[C@@H](O)c3ccc(Cl)nc3)cc2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C36H34ClN3O5S/c37-35-18-13-29(22-39-35)33(41)24-40(23-27-7-3-1-4-8-27)20-19-26-11-14-30(15-12-26)46(43,44)31-16-17-34(32(21-31)36(38)42)45-25-28-9-5-2-6-10-28/h1-18,21-22,33,41H,19-20,23-25H2,(H2,38,42)/t33-/m1/s1 |
| InChIKey | YCIBBMBDVYPTKS-MGBGTMOVSA-N |
| XLogP | 6.02 |
| TPSA | 122.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.20 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|