C38H38ClN3O5S — CID 87967671
5-[4-[2-[[(1R)-1-(6-chloro-3-pyridinyl)-1-hydroxy-3-phenylpropan-2-yl]amino]ethyl]phenyl]sulfonyl-N-ethyl-2-phenylmethoxybenzamide (PubChem CID 87967671) has the molecular formula C38H38ClN3O5S and a molecular weight of 684.26 g/mol. Its IUPAC name is 5-[4-[2-[[(1R)-1-(6-chloro-3-pyridinyl)-1-hydroxy-3-phenylpropan-2-yl]amino]ethyl]phenyl]sulfonyl-N-ethyl-2-phenylmethoxybenzamide.
| Compound Name | 5-[4-[2-[[(1R)-1-(6-chloro-3-pyridinyl)-1-hydroxy-3-phenylpropan-2-yl]amino]ethyl]phenyl]sulfonyl-N-ethyl-2-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 87967671 |
| Molecular Formula | C38H38ClN3O5S |
| Molecular Weight | 684.26 g/mol |
| Exact Mass | 683.22 |
| IUPAC Name | 5-[4-[2-[[(1R)-1-(6-chloro-3-pyridinyl)-1-hydroxy-3-phenylpropan-2-yl]amino]ethyl]phenyl]sulfonyl-N-ethyl-2-phenylmethoxybenzamide |
| SMILES | CCNC(=O)c1cc(S(=O)(=O)c2ccc(CCNC(Cc3ccccc3)[C@H](O)c3ccc(Cl)nc3)cc2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C38H38ClN3O5S/c1-2-40-38(44)33-24-32(18-19-35(33)47-26-29-11-7-4-8-12-29)48(45,46)31-16-13-27(14-17-31)21-22-41-34(23-28-9-5-3-6-10-28)37(43)30-15-20-36(39)42-25-30/h3-20,24-25,34,37,41,43H,2,21-23,26H2,1H3,(H,40,44)/t34?,37-/m1/s1 |
| InChIKey | NTGKMLMDPXZRDU-LZHPWXRPSA-N |
| XLogP | 6.37 |
| TPSA | 117.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.26 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|