C37H35ClN2O6S — CID 87968490
3-[4-[2-[benzyl-[(2R)-2-(6-chloro-3-pyridinyl)-2-hydroxyethyl]amino]ethyl]phenyl]sulfonyl-5-methyl-2-phenylmethoxybenzoic acid (PubChem CID 87968490) has the molecular formula C37H35ClN2O6S and a molecular weight of 671.22 g/mol. Its IUPAC name is 3-[4-[2-[benzyl-[(2R)-2-(6-chloro-3-pyridinyl)-2-hydroxyethyl]amino]ethyl]phenyl]sulfonyl-5-methyl-2-phenylmethoxybenzoic acid.
| Compound Name | 3-[4-[2-[benzyl-[(2R)-2-(6-chloro-3-pyridinyl)-2-hydroxyethyl]amino]ethyl]phenyl]sulfonyl-5-methyl-2-phenylmethoxybenzoic acid |
|---|---|
| PubChem CID | 87968490 |
| Molecular Formula | C37H35ClN2O6S |
| Molecular Weight | 671.22 g/mol |
| Exact Mass | 670.19 |
| IUPAC Name | 3-[4-[2-[benzyl-[(2R)-2-(6-chloro-3-pyridinyl)-2-hydroxyethyl]amino]ethyl]phenyl]sulfonyl-5-methyl-2-phenylmethoxybenzoic acid |
| SMILES | Cc1cc(C(=O)O)c(OCc2ccccc2)c(S(=O)(=O)c2ccc(CCN(Cc3ccccc3)C[C@H](O)c3ccc(Cl)nc3)cc2)c1 |
| InChI | InChI=1S/C37H35ClN2O6S/c1-26-20-32(37(42)43)36(46-25-29-10-6-3-7-11-29)34(21-26)47(44,45)31-15-12-27(13-16-31)18-19-40(23-28-8-4-2-5-9-28)24-33(41)30-14-17-35(38)39-22-30/h2-17,20-22,33,41H,18-19,23-25H2,1H3,(H,42,43)/t33-/m0/s1 |
| InChIKey | DZXJMJNMKXSWSU-XIFFEERXSA-N |
| XLogP | 6.93 |
| TPSA | 117.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.22 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|