C31H31ClN2O5S — CID 90755971
methyl 4-[4-[2-[benzyl-[2-(6-chloro-3-pyridinyl)-2-hydroxyethyl]amino]propyl]phenyl]sulfonylbenzoate (PubChem CID 90755971) has the molecular formula C31H31ClN2O5S and a molecular weight of 579.12 g/mol. Its IUPAC name is methyl 4-[4-[2-[benzyl-[2-(6-chloro-3-pyridinyl)-2-hydroxyethyl]amino]propyl]phenyl]sulfonylbenzoate.
| Compound Name | methyl 4-[4-[2-[benzyl-[2-(6-chloro-3-pyridinyl)-2-hydroxyethyl]amino]propyl]phenyl]sulfonylbenzoate |
|---|---|
| PubChem CID | 90755971 |
| Molecular Formula | C31H31ClN2O5S |
| Molecular Weight | 579.12 g/mol |
| Exact Mass | 578.16 |
| IUPAC Name | methyl 4-[4-[2-[benzyl-[2-(6-chloro-3-pyridinyl)-2-hydroxyethyl]amino]propyl]phenyl]sulfonylbenzoate |
| SMILES | COC(=O)c1ccc(S(=O)(=O)c2ccc(CC(C)N(Cc3ccccc3)CC(O)c3ccc(Cl)nc3)cc2)cc1 |
| InChI | InChI=1S/C31H31ClN2O5S/c1-22(34(20-24-6-4-3-5-7-24)21-29(35)26-12-17-30(32)33-19-26)18-23-8-13-27(14-9-23)40(37,38)28-15-10-25(11-16-28)31(36)39-2/h3-17,19,22,29,35H,18,20-21H2,1-2H3 |
| InChIKey | NOBZABMIYXZGNU-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 96.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.12 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|