C20H16Cl2N2O4S — CID 66601084
methyl 4-[benzyl-(3,5-dichloro-2-pyridinyl)sulfamoyl]benzoate (PubChem CID 66601084) has the molecular formula C20H16Cl2N2O4S and a molecular weight of 451.33 g/mol. Its IUPAC name is methyl 4-[benzyl-(3,5-dichloro-2-pyridinyl)sulfamoyl]benzoate.
| Compound Name | methyl 4-[benzyl-(3,5-dichloro-2-pyridinyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 66601084 |
| Molecular Formula | C20H16Cl2N2O4S |
| Molecular Weight | 451.33 g/mol |
| Exact Mass | 450.02 |
| IUPAC Name | methyl 4-[benzyl-(3,5-dichloro-2-pyridinyl)sulfamoyl]benzoate |
| SMILES | COC(=O)c1ccc(S(=O)(=O)N(Cc2ccccc2)c2ncc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C20H16Cl2N2O4S/c1-28-20(25)15-7-9-17(10-8-15)29(26,27)24(13-14-5-3-2-4-6-14)19-18(22)11-16(21)12-23-19/h2-12H,13H2,1H3 |
| InChIKey | FQVZJHJSLFVFRH-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.33 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |