C19H15ClN2O4S — CID 70829040
6-[benzenesulfonyl-[(4-chlorophenyl)methyl]amino]pyridine-3-carboxylic acid (PubChem CID 70829040) has the molecular formula C19H15ClN2O4S and a molecular weight of 402.86 g/mol. Its IUPAC name is 6-[benzenesulfonyl-[(4-chlorophenyl)methyl]amino]pyridine-3-carboxylic acid.
| Compound Name | 6-[benzenesulfonyl-[(4-chlorophenyl)methyl]amino]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 70829040 |
| Molecular Formula | C19H15ClN2O4S |
| Molecular Weight | 402.86 g/mol |
| Exact Mass | 402.04 |
| IUPAC Name | 6-[benzenesulfonyl-[(4-chlorophenyl)methyl]amino]pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1ccc(N(Cc2ccc(Cl)cc2)S(=O)(=O)c2ccccc2)nc1 |
| InChI | InChI=1S/C19H15ClN2O4S/c20-16-9-6-14(7-10-16)13-22(18-11-8-15(12-21-18)19(23)24)27(25,26)17-4-2-1-3-5-17/h1-12H,13H2,(H,23,24) |
| InChIKey | KIQOGMVGQHBAOA-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.86 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |