C32H24BrClN2O3S — CID 102095863
4-[(4-bromophenyl)sulfonyl-[(4-chlorophenyl)methyl]amino]-N,N-diphenylbenzamide (PubChem CID 102095863) has the molecular formula C32H24BrClN2O3S and a molecular weight of 631.98 g/mol. Its IUPAC name is 4-[(4-bromophenyl)sulfonyl-[(4-chlorophenyl)methyl]amino]-N,N-diphenylbenzamide.
| Compound Name | 4-[(4-bromophenyl)sulfonyl-[(4-chlorophenyl)methyl]amino]-N,N-diphenylbenzamide |
|---|---|
| PubChem CID | 102095863 |
| Molecular Formula | C32H24BrClN2O3S |
| Molecular Weight | 631.98 g/mol |
| Exact Mass | 630.04 |
| IUPAC Name | 4-[(4-bromophenyl)sulfonyl-[(4-chlorophenyl)methyl]amino]-N,N-diphenylbenzamide |
| SMILES | O=C(c1ccc(N(Cc2ccc(Cl)cc2)S(=O)(=O)c2ccc(Br)cc2)cc1)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H24BrClN2O3S/c33-26-15-21-31(22-16-26)40(38,39)35(23-24-11-17-27(34)18-12-24)28-19-13-25(14-20-28)32(37)36(29-7-3-1-4-8-29)30-9-5-2-6-10-30/h1-22H,23H2 |
| InChIKey | GDKPIPSECLHKCK-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.98 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |