C24H25ClN2O2S — CID 71624432
4-chloro-N-phenyl-N-[(4-piperidin-1-ylphenyl)methyl]benzenesulfonamide (PubChem CID 71624432) has the molecular formula C24H25ClN2O2S and a molecular weight of 441.00 g/mol. Its IUPAC name is 4-chloro-N-phenyl-N-[(4-piperidin-1-ylphenyl)methyl]benzenesulfonamide.
| Compound Name | 4-chloro-N-phenyl-N-[(4-piperidin-1-ylphenyl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 71624432 |
| Molecular Formula | C24H25ClN2O2S |
| Molecular Weight | 441.00 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | 4-chloro-N-phenyl-N-[(4-piperidin-1-ylphenyl)methyl]benzenesulfonamide |
| SMILES | O=S(=O)(c1ccc(Cl)cc1)N(Cc1ccc(N2CCCCC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C24H25ClN2O2S/c25-21-11-15-24(16-12-21)30(28,29)27(23-7-3-1-4-8-23)19-20-9-13-22(14-10-20)26-17-5-2-6-18-26/h1,3-4,7-16H,2,5-6,17-19H2 |
| InChIKey | HNBCLYRQPDYRSL-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.00 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|