C19H15BrClNO2S — CID 46021781
N-benzyl-N-(3-bromophenyl)-4-chlorobenzenesulfonamide (PubChem CID 46021781) has the molecular formula C19H15BrClNO2S and a molecular weight of 436.76 g/mol. Its IUPAC name is N-benzyl-N-(3-bromophenyl)-4-chlorobenzenesulfonamide.
| Compound Name | N-benzyl-N-(3-bromophenyl)-4-chlorobenzenesulfonamide |
|---|---|
| PubChem CID | 46021781 |
| Molecular Formula | C19H15BrClNO2S |
| Molecular Weight | 436.76 g/mol |
| Exact Mass | 434.97 |
| IUPAC Name | N-benzyl-N-(3-bromophenyl)-4-chlorobenzenesulfonamide |
| SMILES | O=S(=O)(c1ccc(Cl)cc1)N(Cc1ccccc1)c1cccc(Br)c1 |
| InChI | InChI=1S/C19H15BrClNO2S/c20-16-7-4-8-18(13-16)22(14-15-5-2-1-3-6-15)25(23,24)19-11-9-17(21)10-12-19/h1-13H,14H2 |
| InChIKey | MGUPWOHSDRCMOD-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.76 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |