C20H14ClN3O4S — CID 118719633
4-[benzyl-(3-chloro-5-cyano-2-pyridinyl)sulfamoyl]benzoic acid (PubChem CID 118719633) has the molecular formula C20H14ClN3O4S and a molecular weight of 427.87 g/mol. Its IUPAC name is 4-[benzyl-(3-chloro-5-cyano-2-pyridinyl)sulfamoyl]benzoic acid.
| Compound Name | 4-[benzyl-(3-chloro-5-cyano-2-pyridinyl)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 118719633 |
| Molecular Formula | C20H14ClN3O4S |
| Molecular Weight | 427.87 g/mol |
| Exact Mass | 427.04 |
| IUPAC Name | 4-[benzyl-(3-chloro-5-cyano-2-pyridinyl)sulfamoyl]benzoic acid |
| SMILES | N#Cc1cnc(N(Cc2ccccc2)S(=O)(=O)c2ccc(C(=O)O)cc2)c(Cl)c1 |
| InChI | InChI=1S/C20H14ClN3O4S/c21-18-10-15(11-22)12-23-19(18)24(13-14-4-2-1-3-5-14)29(27,28)17-8-6-16(7-9-17)20(25)26/h1-10,12H,13H2,(H,25,26) |
| InChIKey | XXTHOHPFBLTZIQ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 111.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.87 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |