C28H23F5N2O5S — CID 91937495
4-[(4-methylisoquinolin-3-yl)-[[4-(3,3,4,4,4-pentafluoro-2-hydroxybutan-2-yl)phenyl]methyl]sulfamoyl]benzoic acid (PubChem CID 91937495) has the molecular formula C28H23F5N2O5S and a molecular weight of 594.56 g/mol. Its IUPAC name is 4-[(4-methylisoquinolin-3-yl)-[[4-(3,3,4,4,4-pentafluoro-2-hydroxybutan-2-yl)phenyl]methyl]sulfamoyl]benzoic acid.
| Compound Name | 4-[(4-methylisoquinolin-3-yl)-[[4-(3,3,4,4,4-pentafluoro-2-hydroxybutan-2-yl)phenyl]methyl]sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 91937495 |
| Molecular Formula | C28H23F5N2O5S |
| Molecular Weight | 594.56 g/mol |
| Exact Mass | 594.12 |
| IUPAC Name | 4-[(4-methylisoquinolin-3-yl)-[[4-(3,3,4,4,4-pentafluoro-2-hydroxybutan-2-yl)phenyl]methyl]sulfamoyl]benzoic acid |
| SMILES | Cc1c(N(Cc2ccc(C(C)(O)C(F)(F)C(F)(F)F)cc2)S(=O)(=O)c2ccc(C(=O)O)cc2)ncc2ccccc12 |
| InChI | InChI=1S/C28H23F5N2O5S/c1-17-23-6-4-3-5-20(23)15-34-24(17)35(41(39,40)22-13-9-19(10-14-22)25(36)37)16-18-7-11-21(12-8-18)26(2,38)27(29,30)28(31,32)33/h3-15,38H,16H2,1-2H3,(H,36,37) |
| InChIKey | NAUWAJMIDHDCKJ-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 107.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.56 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|