C27H20N3NaO4S — CID 91937478
sodium 4-[(4-methylisoquinolin-3-yl)-(quinolin-3-ylmethyl)sulfamoyl]benzoate (PubChem CID 91937478) has the molecular formula C27H20N3NaO4S and a molecular weight of 505.53 g/mol. Its IUPAC name is sodium 4-[(4-methylisoquinolin-3-yl)-(quinolin-3-ylmethyl)sulfamoyl]benzoate.
| Compound Name | sodium 4-[(4-methylisoquinolin-3-yl)-(quinolin-3-ylmethyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 91937478 |
| Molecular Formula | C27H20N3NaO4S |
| Molecular Weight | 505.53 g/mol |
| Exact Mass | 505.11 |
| IUPAC Name | sodium 4-[(4-methylisoquinolin-3-yl)-(quinolin-3-ylmethyl)sulfamoyl]benzoate |
| SMILES | Cc1c(N(Cc2cnc3ccccc3c2)S(=O)(=O)c2ccc(C(=O)[O-])cc2)ncc2ccccc12.[Na+] |
| InChI | InChI=1S/C27H21N3O4S.Na/c1-18-24-8-4-2-7-22(24)16-29-26(18)30(17-19-14-21-6-3-5-9-25(21)28-15-19)35(33,34)23-12-10-20(11-13-23)27(31)32;/h2-16H,17H2,1H3,(H,31,32);/q;+1/p-1 |
| InChIKey | WLRWXHUCRQDGET-UHFFFAOYSA-M |
| XLogP | 0.85 |
| TPSA | 103.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.53 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |