C28H24ClN3O4S — CID 91937475
4-[(5-chloro-1-ethylindol-2-yl)methyl-(4-methylisoquinolin-3-yl)sulfamoyl]benzoic acid (PubChem CID 91937475) has the molecular formula C28H24ClN3O4S and a molecular weight of 534.04 g/mol. Its IUPAC name is 4-[(5-chloro-1-ethylindol-2-yl)methyl-(4-methylisoquinolin-3-yl)sulfamoyl]benzoic acid.
| Compound Name | 4-[(5-chloro-1-ethylindol-2-yl)methyl-(4-methylisoquinolin-3-yl)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 91937475 |
| Molecular Formula | C28H24ClN3O4S |
| Molecular Weight | 534.04 g/mol |
| Exact Mass | 533.12 |
| IUPAC Name | 4-[(5-chloro-1-ethylindol-2-yl)methyl-(4-methylisoquinolin-3-yl)sulfamoyl]benzoic acid |
| SMILES | CCn1c(CN(c2ncc3ccccc3c2C)S(=O)(=O)c2ccc(C(=O)O)cc2)cc2cc(Cl)ccc21 |
| InChI | InChI=1S/C28H24ClN3O4S/c1-3-31-23(15-21-14-22(29)10-13-26(21)31)17-32(27-18(2)25-7-5-4-6-20(25)16-30-27)37(35,36)24-11-8-19(9-12-24)28(33)34/h4-16H,3,17H2,1-2H3,(H,33,34) |
| InChIKey | IXKDJXLFAVUVBU-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.04 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |