C24H16BrF3N2O5S — CID 91937463
4-[(4-bromoisoquinolin-3-yl)-[[4-(trifluoromethoxy)phenyl]methyl]sulfamoyl]benzoic acid (PubChem CID 91937463) has the molecular formula C24H16BrF3N2O5S and a molecular weight of 581.37 g/mol. Its IUPAC name is 4-[(4-bromoisoquinolin-3-yl)-[[4-(trifluoromethoxy)phenyl]methyl]sulfamoyl]benzoic acid.
| Compound Name | 4-[(4-bromoisoquinolin-3-yl)-[[4-(trifluoromethoxy)phenyl]methyl]sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 91937463 |
| Molecular Formula | C24H16BrF3N2O5S |
| Molecular Weight | 581.37 g/mol |
| Exact Mass | 579.99 |
| IUPAC Name | 4-[(4-bromoisoquinolin-3-yl)-[[4-(trifluoromethoxy)phenyl]methyl]sulfamoyl]benzoic acid |
| SMILES | O=C(O)c1ccc(S(=O)(=O)N(Cc2ccc(OC(F)(F)F)cc2)c2ncc3ccccc3c2Br)cc1 |
| InChI | InChI=1S/C24H16BrF3N2O5S/c25-21-20-4-2-1-3-17(20)13-29-22(21)30(14-15-5-9-18(10-6-15)35-24(26,27)28)36(33,34)19-11-7-16(8-12-19)23(31)32/h1-13H,14H2,(H,31,32) |
| InChIKey | LHNBFCNSTMJWKJ-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 96.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.37 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |