C27H22BrF3N2O5S — CID 150487336
4-[(1-bromo-4,5-dimethylisoquinolin-3-yl)-[[4-(trifluoromethoxy)phenyl]methyl]sulfamoyl]-2-methylbenzoic acid (PubChem CID 150487336) has the molecular formula C27H22BrF3N2O5S and a molecular weight of 623.45 g/mol. Its IUPAC name is 4-[(1-bromo-4,5-dimethylisoquinolin-3-yl)-[[4-(trifluoromethoxy)phenyl]methyl]sulfamoyl]-2-methylbenzoic acid.
| Compound Name | 4-[(1-bromo-4,5-dimethylisoquinolin-3-yl)-[[4-(trifluoromethoxy)phenyl]methyl]sulfamoyl]-2-methylbenzoic acid |
|---|---|
| PubChem CID | 150487336 |
| Molecular Formula | C27H22BrF3N2O5S |
| Molecular Weight | 623.45 g/mol |
| Exact Mass | 622.04 |
| IUPAC Name | 4-[(1-bromo-4,5-dimethylisoquinolin-3-yl)-[[4-(trifluoromethoxy)phenyl]methyl]sulfamoyl]-2-methylbenzoic acid |
| SMILES | Cc1cc(S(=O)(=O)N(Cc2ccc(OC(F)(F)F)cc2)c2nc(Br)c3cccc(C)c3c2C)ccc1C(=O)O |
| InChI | InChI=1S/C27H22BrF3N2O5S/c1-15-5-4-6-22-23(15)17(3)25(32-24(22)28)33(14-18-7-9-19(10-8-18)38-27(29,30)31)39(36,37)20-11-12-21(26(34)35)16(2)13-20/h4-13H,14H2,1-3H3,(H,34,35) |
| InChIKey | HVBHTKSQQJXYMD-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 96.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.45 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|