C26H24F3N3O4S — CID 152593525
4-[(methoxyamino)methyl]-N-(4-methylisoquinolin-3-yl)-N-[[4-(trifluoromethoxy)phenyl]methyl]benzenesulfonamide (PubChem CID 152593525) has the molecular formula C26H24F3N3O4S and a molecular weight of 531.56 g/mol. Its IUPAC name is 4-[(methoxyamino)methyl]-N-(4-methylisoquinolin-3-yl)-N-[[4-(trifluoromethoxy)phenyl]methyl]benzenesulfonamide.
| Compound Name | 4-[(methoxyamino)methyl]-N-(4-methylisoquinolin-3-yl)-N-[[4-(trifluoromethoxy)phenyl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 152593525 |
| Molecular Formula | C26H24F3N3O4S |
| Molecular Weight | 531.56 g/mol |
| Exact Mass | 531.14 |
| IUPAC Name | 4-[(methoxyamino)methyl]-N-(4-methylisoquinolin-3-yl)-N-[[4-(trifluoromethoxy)phenyl]methyl]benzenesulfonamide |
| SMILES | CONCc1ccc(S(=O)(=O)N(Cc2ccc(OC(F)(F)F)cc2)c2ncc3ccccc3c2C)cc1 |
| InChI | InChI=1S/C26H24F3N3O4S/c1-18-24-6-4-3-5-21(24)16-30-25(18)32(17-20-7-11-22(12-8-20)36-26(27,28)29)37(33,34)23-13-9-19(10-14-23)15-31-35-2/h3-14,16,31H,15,17H2,1-2H3 |
| InChIKey | YVYYPTMJLMFMMN-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.56 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|