C23H21Cl2NO4S — CID 66978824
4-[[(3,4-dichlorophenyl)sulfonyl-(3-phenylpropyl)amino]methyl]benzoic acid (PubChem CID 66978824) has the molecular formula C23H21Cl2NO4S and a molecular weight of 478.40 g/mol. Its IUPAC name is 4-[[(3,4-dichlorophenyl)sulfonyl-(3-phenylpropyl)amino]methyl]benzoic acid.
| Compound Name | 4-[[(3,4-dichlorophenyl)sulfonyl-(3-phenylpropyl)amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 66978824 |
| Molecular Formula | C23H21Cl2NO4S |
| Molecular Weight | 478.40 g/mol |
| Exact Mass | 477.06 |
| IUPAC Name | 4-[[(3,4-dichlorophenyl)sulfonyl-(3-phenylpropyl)amino]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CN(CCCc2ccccc2)S(=O)(=O)c2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C23H21Cl2NO4S/c24-21-13-12-20(15-22(21)25)31(29,30)26(14-4-7-17-5-2-1-3-6-17)16-18-8-10-19(11-9-18)23(27)28/h1-3,5-6,8-13,15H,4,7,14,16H2,(H,27,28) |
| InChIKey | BGOGERXAGKLDKT-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.40 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |