C35H34N2O3S — CID 3930265
N-benzyl-3-[benzyl(naphthalen-2-ylsulfonyl)amino]-N-(2-phenylethyl)propanamide (PubChem CID 3930265) has the molecular formula C35H34N2O3S and a molecular weight of 562.74 g/mol. Its IUPAC name is N-benzyl-3-[benzyl(naphthalen-2-ylsulfonyl)amino]-N-(2-phenylethyl)propanamide.
| Compound Name | N-benzyl-3-[benzyl(naphthalen-2-ylsulfonyl)amino]-N-(2-phenylethyl)propanamide |
|---|---|
| PubChem CID | 3930265 |
| Molecular Formula | C35H34N2O3S |
| Molecular Weight | 562.74 g/mol |
| Exact Mass | 562.23 |
| IUPAC Name | N-benzyl-3-[benzyl(naphthalen-2-ylsulfonyl)amino]-N-(2-phenylethyl)propanamide |
| SMILES | O=C(CCN(Cc1ccccc1)S(=O)(=O)c1ccc2ccccc2c1)N(CCc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C35H34N2O3S/c38-35(36(27-30-14-6-2-7-15-30)24-22-29-12-4-1-5-13-29)23-25-37(28-31-16-8-3-9-17-31)41(39,40)34-21-20-32-18-10-11-19-33(32)26-34/h1-21,26H,22-25,27-28H2 |
| InChIKey | KFYLNYNCOPGDKO-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.74 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |