C29H32N2O4S — CID 42696393
N-[2-(3,4-dimethoxyphenyl)ethyl]-N-[[4-(dimethylamino)phenyl]methyl]naphthalene-2-sulfonamide (PubChem CID 42696393) has the molecular formula C29H32N2O4S and a molecular weight of 504.65 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-N-[[4-(dimethylamino)phenyl]methyl]naphthalene-2-sulfonamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-N-[[4-(dimethylamino)phenyl]methyl]naphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 42696393 |
| Molecular Formula | C29H32N2O4S |
| Molecular Weight | 504.65 g/mol |
| Exact Mass | 504.21 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-N-[[4-(dimethylamino)phenyl]methyl]naphthalene-2-sulfonamide |
| SMILES | COc1ccc(CCN(Cc2ccc(N(C)C)cc2)S(=O)(=O)c2ccc3ccccc3c2)cc1OC |
| InChI | InChI=1S/C29H32N2O4S/c1-30(2)26-13-9-23(10-14-26)21-31(18-17-22-11-16-28(34-3)29(19-22)35-4)36(32,33)27-15-12-24-7-5-6-8-25(24)20-27/h5-16,19-20H,17-18,21H2,1-4H3 |
| InChIKey | UWDZVRLLQDNXSW-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.65 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|