C21H21NO4S — CID 100532098
N-(3,4-dimethoxyphenyl)-N-prop-2-enylnaphthalene-2-sulfonamide (PubChem CID 100532098) has the molecular formula C21H21NO4S and a molecular weight of 383.47 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-N-prop-2-enylnaphthalene-2-sulfonamide.
| Compound Name | N-(3,4-dimethoxyphenyl)-N-prop-2-enylnaphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 100532098 |
| Molecular Formula | C21H21NO4S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-N-prop-2-enylnaphthalene-2-sulfonamide |
| SMILES | C=CCN(c1ccc(OC)c(OC)c1)S(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C21H21NO4S/c1-4-13-22(18-10-12-20(25-2)21(15-18)26-3)27(23,24)19-11-9-16-7-5-6-8-17(16)14-19/h4-12,14-15H,1,13H2,2-3H3 |
| InChIKey | HHPPRGJVOMTHCA-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|