C19H16ClNO2S — CID 100530860
N-(2-chlorophenyl)-N-prop-2-enylnaphthalene-2-sulfonamide (PubChem CID 100530860) has the molecular formula C19H16ClNO2S and a molecular weight of 357.86 g/mol. Its IUPAC name is N-(2-chlorophenyl)-N-prop-2-enylnaphthalene-2-sulfonamide.
| Compound Name | N-(2-chlorophenyl)-N-prop-2-enylnaphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 100530860 |
| Molecular Formula | C19H16ClNO2S |
| Molecular Weight | 357.86 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | N-(2-chlorophenyl)-N-prop-2-enylnaphthalene-2-sulfonamide |
| SMILES | C=CCN(c1ccccc1Cl)S(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C19H16ClNO2S/c1-2-13-21(19-10-6-5-9-18(19)20)24(22,23)17-12-11-15-7-3-4-8-16(15)14-17/h2-12,14H,1,13H2 |
| InChIKey | PJDHWULHAZYRQF-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.86 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|