C28H35NO5S — CID 58713380
2-methyl-2-[4-[3-[naphthalen-2-ylsulfonyl(pentyl)amino]propyl]phenoxy]propanoic acid (PubChem CID 58713380) has the molecular formula C28H35NO5S and a molecular weight of 497.66 g/mol. Its IUPAC name is 2-methyl-2-[4-[3-[naphthalen-2-ylsulfonyl(pentyl)amino]propyl]phenoxy]propanoic acid.
| Compound Name | 2-methyl-2-[4-[3-[naphthalen-2-ylsulfonyl(pentyl)amino]propyl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 58713380 |
| Molecular Formula | C28H35NO5S |
| Molecular Weight | 497.66 g/mol |
| Exact Mass | 497.22 |
| IUPAC Name | 2-methyl-2-[4-[3-[naphthalen-2-ylsulfonyl(pentyl)amino]propyl]phenoxy]propanoic acid |
| SMILES | CCCCCN(CCCc1ccc(OC(C)(C)C(=O)O)cc1)S(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C28H35NO5S/c1-4-5-8-19-29(35(32,33)26-18-15-23-11-6-7-12-24(23)21-26)20-9-10-22-13-16-25(17-14-22)34-28(2,3)27(30)31/h6-7,11-18,21H,4-5,8-10,19-20H2,1-3H3,(H,30,31) |
| InChIKey | GBTWJJFKENPOQU-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.66 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|