C29H42N2O7 — CID 22924186
2-[4-[2-[heptyl-[(2,4,6-trimethoxyphenyl)carbamoyl]amino]ethyl]phenoxy]-2-methylpropanoic acid (PubChem CID 22924186) has the molecular formula C29H42N2O7 and a molecular weight of 530.66 g/mol. Its IUPAC name is 2-[4-[2-[heptyl-[(2,4,6-trimethoxyphenyl)carbamoyl]amino]ethyl]phenoxy]-2-methylpropanoic acid.
| Compound Name | 2-[4-[2-[heptyl-[(2,4,6-trimethoxyphenyl)carbamoyl]amino]ethyl]phenoxy]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 22924186 |
| Molecular Formula | C29H42N2O7 |
| Molecular Weight | 530.66 g/mol |
| Exact Mass | 530.30 |
| IUPAC Name | 2-[4-[2-[heptyl-[(2,4,6-trimethoxyphenyl)carbamoyl]amino]ethyl]phenoxy]-2-methylpropanoic acid |
| SMILES | CCCCCCCN(CCc1ccc(OC(C)(C)C(=O)O)cc1)C(=O)Nc1c(OC)cc(OC)cc1OC |
| InChI | InChI=1S/C29H42N2O7/c1-7-8-9-10-11-17-31(18-16-21-12-14-22(15-13-21)38-29(2,3)27(32)33)28(34)30-26-24(36-5)19-23(35-4)20-25(26)37-6/h12-15,19-20H,7-11,16-18H2,1-6H3,(H,30,34)(H,32,33) |
| InChIKey | YWINLQIYUQDMLF-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 106.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.66 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|