C39H56N2O7 — CID 19934082
3-[2-(3,3-dimethyl-1-phenylbutoxy)-4,6-dimethoxyphenyl]-1-heptyl-1-[[4-(2-methoxyethoxymethoxy)phenyl]methyl]urea (PubChem CID 19934082) has the molecular formula C39H56N2O7 and a molecular weight of 664.88 g/mol. Its IUPAC name is 3-[2-(3,3-dimethyl-1-phenylbutoxy)-4,6-dimethoxyphenyl]-1-heptyl-1-[[4-(2-methoxyethoxymethoxy)phenyl]methyl]urea.
| Compound Name | 3-[2-(3,3-dimethyl-1-phenylbutoxy)-4,6-dimethoxyphenyl]-1-heptyl-1-[[4-(2-methoxyethoxymethoxy)phenyl]methyl]urea |
|---|---|
| PubChem CID | 19934082 |
| Molecular Formula | C39H56N2O7 |
| Molecular Weight | 664.88 g/mol |
| Exact Mass | 664.41 |
| IUPAC Name | 3-[2-(3,3-dimethyl-1-phenylbutoxy)-4,6-dimethoxyphenyl]-1-heptyl-1-[[4-(2-methoxyethoxymethoxy)phenyl]methyl]urea |
| SMILES | CCCCCCCN(Cc1ccc(OCOCCOC)cc1)C(=O)Nc1c(OC)cc(OC)cc1OC(CC(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C39H56N2O7/c1-8-9-10-11-15-22-41(28-30-18-20-32(21-19-30)47-29-46-24-23-43-5)38(42)40-37-34(45-7)25-33(44-6)26-35(37)48-36(27-39(2,3)4)31-16-13-12-14-17-31/h12-14,16-21,25-26,36H,8-11,15,22-24,27-29H2,1-7H3,(H,40,42) |
| InChIKey | MZTVTVSGBVGPTB-UHFFFAOYSA-N |
| XLogP | 9.26 |
| TPSA | 87.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.88 |
| LogP ≤ 5 | 9.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|