C27H38F2N2O2 — CID 15137652
3-(2,4-difluorophenyl)-1-heptyl-1-[[4-(4-methylpentoxy)phenyl]methyl]urea (PubChem CID 15137652) has the molecular formula C27H38F2N2O2 and a molecular weight of 460.61 g/mol. Its IUPAC name is 3-(2,4-difluorophenyl)-1-heptyl-1-[[4-(4-methylpentoxy)phenyl]methyl]urea.
| Compound Name | 3-(2,4-difluorophenyl)-1-heptyl-1-[[4-(4-methylpentoxy)phenyl]methyl]urea |
|---|---|
| PubChem CID | 15137652 |
| Molecular Formula | C27H38F2N2O2 |
| Molecular Weight | 460.61 g/mol |
| Exact Mass | 460.29 |
| IUPAC Name | 3-(2,4-difluorophenyl)-1-heptyl-1-[[4-(4-methylpentoxy)phenyl]methyl]urea |
| SMILES | CCCCCCCN(Cc1ccc(OCCCC(C)C)cc1)C(=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C27H38F2N2O2/c1-4-5-6-7-8-17-31(27(32)30-26-16-13-23(28)19-25(26)29)20-22-11-14-24(15-12-22)33-18-9-10-21(2)3/h11-16,19,21H,4-10,17-18,20H2,1-3H3,(H,30,32) |
| InChIKey | JPRSDFLMCMDWQF-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.61 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|