C31H38Cl2N2O2 — CID 15137610
3-(2,4-dichlorophenyl)-1-[(4-pentoxyphenyl)methyl]-1-[(4-pentylphenyl)methyl]urea (PubChem CID 15137610) has the molecular formula C31H38Cl2N2O2 and a molecular weight of 541.56 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-1-[(4-pentoxyphenyl)methyl]-1-[(4-pentylphenyl)methyl]urea.
| Compound Name | 3-(2,4-dichlorophenyl)-1-[(4-pentoxyphenyl)methyl]-1-[(4-pentylphenyl)methyl]urea |
|---|---|
| PubChem CID | 15137610 |
| Molecular Formula | C31H38Cl2N2O2 |
| Molecular Weight | 541.56 g/mol |
| Exact Mass | 540.23 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-1-[(4-pentoxyphenyl)methyl]-1-[(4-pentylphenyl)methyl]urea |
| SMILES | CCCCCOc1ccc(CN(Cc2ccc(CCCCC)cc2)C(=O)Nc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C31H38Cl2N2O2/c1-3-5-7-9-24-10-12-25(13-11-24)22-35(31(36)34-30-19-16-27(32)21-29(30)33)23-26-14-17-28(18-15-26)37-20-8-6-4-2/h10-19,21H,3-9,20,22-23H2,1-2H3,(H,34,36) |
| InChIKey | YPWJMCVFKRDPCA-UHFFFAOYSA-N |
| XLogP | 9.53 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.56 |
| LogP ≤ 5 | 9.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|