C25H35ClN2O2 — CID 15137699
1-[(4-butylphenyl)methyl]-3-(4-chloro-2-methylphenyl)-1-(6-hydroxyhexyl)urea (PubChem CID 15137699) has the molecular formula C25H35ClN2O2 and a molecular weight of 431.02 g/mol. Its IUPAC name is 1-[(4-butylphenyl)methyl]-3-(4-chloro-2-methylphenyl)-1-(6-hydroxyhexyl)urea.
| Compound Name | 1-[(4-butylphenyl)methyl]-3-(4-chloro-2-methylphenyl)-1-(6-hydroxyhexyl)urea |
|---|---|
| PubChem CID | 15137699 |
| Molecular Formula | C25H35ClN2O2 |
| Molecular Weight | 431.02 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | 1-[(4-butylphenyl)methyl]-3-(4-chloro-2-methylphenyl)-1-(6-hydroxyhexyl)urea |
| SMILES | CCCCc1ccc(CN(CCCCCCO)C(=O)Nc2ccc(Cl)cc2C)cc1 |
| InChI | InChI=1S/C25H35ClN2O2/c1-3-4-9-21-10-12-22(13-11-21)19-28(16-7-5-6-8-17-29)25(30)27-24-15-14-23(26)18-20(24)2/h10-15,18,29H,3-9,16-17,19H2,1-2H3,(H,27,30) |
| InChIKey | VJZQPPAHLDCBSM-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.02 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|