C26H37ClN2O4 — CID 19934045
3-(4-chloro-2-ethoxyphenyl)-1-heptyl-1-[[4-(2-methoxyethoxy)phenyl]methyl]urea (PubChem CID 19934045) has the molecular formula C26H37ClN2O4 and a molecular weight of 477.05 g/mol. Its IUPAC name is 3-(4-chloro-2-ethoxyphenyl)-1-heptyl-1-[[4-(2-methoxyethoxy)phenyl]methyl]urea.
| Compound Name | 3-(4-chloro-2-ethoxyphenyl)-1-heptyl-1-[[4-(2-methoxyethoxy)phenyl]methyl]urea |
|---|---|
| PubChem CID | 19934045 |
| Molecular Formula | C26H37ClN2O4 |
| Molecular Weight | 477.05 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | 3-(4-chloro-2-ethoxyphenyl)-1-heptyl-1-[[4-(2-methoxyethoxy)phenyl]methyl]urea |
| SMILES | CCCCCCCN(Cc1ccc(OCCOC)cc1)C(=O)Nc1ccc(Cl)cc1OCC |
| InChI | InChI=1S/C26H37ClN2O4/c1-4-6-7-8-9-16-29(20-21-10-13-23(14-11-21)33-18-17-31-3)26(30)28-24-15-12-22(27)19-25(24)32-5-2/h10-15,19H,4-9,16-18,20H2,1-3H3,(H,28,30) |
| InChIKey | DYDQDQCWNOZQAN-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.05 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|