C28H42N2O6 — CID 54188863
3-(2,4-dimethoxyphenyl)-1-heptyl-1-[[4-[2-(2-methoxyethoxy)ethoxy]phenyl]methyl]urea (PubChem CID 54188863) has the molecular formula C28H42N2O6 and a molecular weight of 502.65 g/mol. Its IUPAC name is 3-(2,4-dimethoxyphenyl)-1-heptyl-1-[[4-[2-(2-methoxyethoxy)ethoxy]phenyl]methyl]urea.
| Compound Name | 3-(2,4-dimethoxyphenyl)-1-heptyl-1-[[4-[2-(2-methoxyethoxy)ethoxy]phenyl]methyl]urea |
|---|---|
| PubChem CID | 54188863 |
| Molecular Formula | C28H42N2O6 |
| Molecular Weight | 502.65 g/mol |
| Exact Mass | 502.30 |
| IUPAC Name | 3-(2,4-dimethoxyphenyl)-1-heptyl-1-[[4-[2-(2-methoxyethoxy)ethoxy]phenyl]methyl]urea |
| SMILES | CCCCCCCN(Cc1ccc(OCCOCCOC)cc1)C(=O)Nc1ccc(OC)cc1OC |
| InChI | InChI=1S/C28H42N2O6/c1-5-6-7-8-9-16-30(28(31)29-26-15-14-25(33-3)21-27(26)34-4)22-23-10-12-24(13-11-23)36-20-19-35-18-17-32-2/h10-15,21H,5-9,16-20,22H2,1-4H3,(H,29,31) |
| InChIKey | PHBJSNPMQSLPLA-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 78.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.65 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|