C29H42N2O6 — CID 67686131
ethyl 3-[4-[[(2,4-dimethoxyphenyl)carbamoyl-heptylamino]methyl]phenoxy]butanoate (PubChem CID 67686131) has the molecular formula C29H42N2O6 and a molecular weight of 514.66 g/mol. Its IUPAC name is ethyl 3-[4-[[(2,4-dimethoxyphenyl)carbamoyl-heptylamino]methyl]phenoxy]butanoate.
| Compound Name | ethyl 3-[4-[[(2,4-dimethoxyphenyl)carbamoyl-heptylamino]methyl]phenoxy]butanoate |
|---|---|
| PubChem CID | 67686131 |
| Molecular Formula | C29H42N2O6 |
| Molecular Weight | 514.66 g/mol |
| Exact Mass | 514.30 |
| IUPAC Name | ethyl 3-[4-[[(2,4-dimethoxyphenyl)carbamoyl-heptylamino]methyl]phenoxy]butanoate |
| SMILES | CCCCCCCN(Cc1ccc(OC(C)CC(=O)OCC)cc1)C(=O)Nc1ccc(OC)cc1OC |
| InChI | InChI=1S/C29H42N2O6/c1-6-8-9-10-11-18-31(29(33)30-26-17-16-25(34-4)20-27(26)35-5)21-23-12-14-24(15-13-23)37-22(3)19-28(32)36-7-2/h12-17,20,22H,6-11,18-19,21H2,1-5H3,(H,30,33) |
| InChIKey | UHLDVDSYNWQHKA-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.66 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|