C26H34ClF3N2O — CID 154173929
1-[(4-butylphenyl)methyl]-3-[4-chloro-2-(trifluoromethyl)phenyl]-1-heptylurea (PubChem CID 154173929) has the molecular formula C26H34ClF3N2O and a molecular weight of 483.02 g/mol. Its IUPAC name is 1-[(4-butylphenyl)methyl]-3-[4-chloro-2-(trifluoromethyl)phenyl]-1-heptylurea.
| Compound Name | 1-[(4-butylphenyl)methyl]-3-[4-chloro-2-(trifluoromethyl)phenyl]-1-heptylurea |
|---|---|
| PubChem CID | 154173929 |
| Molecular Formula | C26H34ClF3N2O |
| Molecular Weight | 483.02 g/mol |
| Exact Mass | 482.23 |
| IUPAC Name | 1-[(4-butylphenyl)methyl]-3-[4-chloro-2-(trifluoromethyl)phenyl]-1-heptylurea |
| SMILES | CCCCCCCN(Cc1ccc(CCCC)cc1)C(=O)Nc1ccc(Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C26H34ClF3N2O/c1-3-5-7-8-9-17-32(19-21-13-11-20(12-14-21)10-6-4-2)25(33)31-24-16-15-22(27)18-23(24)26(28,29)30/h11-16,18H,3-10,17,19H2,1-2H3,(H,31,33) |
| InChIKey | IJBHBTJBBNENLV-UHFFFAOYSA-N |
| XLogP | 8.71 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.02 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|