C24H32ClF3N4O2 — CID 157270452
3-[4-chloro-2-(trifluoromethyl)phenyl]-1-heptyl-1-(2-phenylethyl)urea;urea (PubChem CID 157270452) has the molecular formula C24H32ClF3N4O2 and a molecular weight of 500.99 g/mol. Its IUPAC name is 3-[4-chloro-2-(trifluoromethyl)phenyl]-1-heptyl-1-(2-phenylethyl)urea;urea.
| Compound Name | 3-[4-chloro-2-(trifluoromethyl)phenyl]-1-heptyl-1-(2-phenylethyl)urea;urea |
|---|---|
| PubChem CID | 157270452 |
| Molecular Formula | C24H32ClF3N4O2 |
| Molecular Weight | 500.99 g/mol |
| Exact Mass | 500.22 |
| IUPAC Name | 3-[4-chloro-2-(trifluoromethyl)phenyl]-1-heptyl-1-(2-phenylethyl)urea;urea |
| SMILES | CCCCCCCN(CCc1ccccc1)C(=O)Nc1ccc(Cl)cc1C(F)(F)F.NC(N)=O |
| InChI | InChI=1S/C23H28ClF3N2O.CH4N2O/c1-2-3-4-5-9-15-29(16-14-18-10-7-6-8-11-18)22(30)28-21-13-12-19(24)17-20(21)23(25,26)27;2-1(3)4/h6-8,10-13,17H,2-5,9,14-16H2,1H3,(H,28,30);(H4,2,3,4) |
| InChIKey | AYLZFPCFEAWXTR-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 101.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.99 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|