C21H23F3N2O3 — CID 42697979
ethyl 3-[2-phenylethyl-[[2-(trifluoromethyl)phenyl]carbamoyl]amino]propanoate (PubChem CID 42697979) has the molecular formula C21H23F3N2O3 and a molecular weight of 408.42 g/mol. Its IUPAC name is ethyl 3-[2-phenylethyl-[[2-(trifluoromethyl)phenyl]carbamoyl]amino]propanoate.
| Compound Name | ethyl 3-[2-phenylethyl-[[2-(trifluoromethyl)phenyl]carbamoyl]amino]propanoate |
|---|---|
| PubChem CID | 42697979 |
| Molecular Formula | C21H23F3N2O3 |
| Molecular Weight | 408.42 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | ethyl 3-[2-phenylethyl-[[2-(trifluoromethyl)phenyl]carbamoyl]amino]propanoate |
| SMILES | CCOC(=O)CCN(CCc1ccccc1)C(=O)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C21H23F3N2O3/c1-2-29-19(27)13-15-26(14-12-16-8-4-3-5-9-16)20(28)25-18-11-7-6-10-17(18)21(22,23)24/h3-11H,2,12-15H2,1H3,(H,25,28) |
| InChIKey | WRQVXQILBCMCFZ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.42 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |