C16H14ClF3N2O — CID 108988898
1-benzyl-3-[4-chloro-2-(trifluoromethyl)phenyl]-1-methylurea (PubChem CID 108988898) has the molecular formula C16H14ClF3N2O and a molecular weight of 342.75 g/mol. Its IUPAC name is 1-benzyl-3-[4-chloro-2-(trifluoromethyl)phenyl]-1-methylurea.
| Compound Name | 1-benzyl-3-[4-chloro-2-(trifluoromethyl)phenyl]-1-methylurea |
|---|---|
| PubChem CID | 108988898 |
| Molecular Formula | C16H14ClF3N2O |
| Molecular Weight | 342.75 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | 1-benzyl-3-[4-chloro-2-(trifluoromethyl)phenyl]-1-methylurea |
| SMILES | CN(Cc1ccccc1)C(=O)Nc1ccc(Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C16H14ClF3N2O/c1-22(10-11-5-3-2-4-6-11)15(23)21-14-8-7-12(17)9-13(14)16(18,19)20/h2-9H,10H2,1H3,(H,21,23) |
| InChIKey | DMWKCRAMWUBXMC-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.75 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |