C12H12ClF3N2O3 — CID 62637544
2-[[4-chloro-2-(trifluoromethyl)phenyl]carbamoyl-methylamino]propanoic acid (PubChem CID 62637544) has the molecular formula C12H12ClF3N2O3 and a molecular weight of 324.69 g/mol. Its IUPAC name is 2-[[4-chloro-2-(trifluoromethyl)phenyl]carbamoyl-methylamino]propanoic acid.
| Compound Name | 2-[[4-chloro-2-(trifluoromethyl)phenyl]carbamoyl-methylamino]propanoic acid |
|---|---|
| PubChem CID | 62637544 |
| Molecular Formula | C12H12ClF3N2O3 |
| Molecular Weight | 324.69 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | 2-[[4-chloro-2-(trifluoromethyl)phenyl]carbamoyl-methylamino]propanoic acid |
| SMILES | CC(C(=O)O)N(C)C(=O)Nc1ccc(Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C12H12ClF3N2O3/c1-6(10(19)20)18(2)11(21)17-9-4-3-7(13)5-8(9)12(14,15)16/h3-6H,1-2H3,(H,17,21)(H,19,20) |
| InChIKey | RDJRQNVFJOVWGM-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.69 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |