C18H16ClF3N2O3 — CID 108523839
N'-benzyl-N-[4-chloro-2-(trifluoromethyl)phenyl]-N'-(2-hydroxyethyl)oxamide (PubChem CID 108523839) has the molecular formula C18H16ClF3N2O3 and a molecular weight of 400.78 g/mol. Its IUPAC name is N'-benzyl-N-[4-chloro-2-(trifluoromethyl)phenyl]-N'-(2-hydroxyethyl)oxamide.
| Compound Name | N'-benzyl-N-[4-chloro-2-(trifluoromethyl)phenyl]-N'-(2-hydroxyethyl)oxamide |
|---|---|
| PubChem CID | 108523839 |
| Molecular Formula | C18H16ClF3N2O3 |
| Molecular Weight | 400.78 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | N'-benzyl-N-[4-chloro-2-(trifluoromethyl)phenyl]-N'-(2-hydroxyethyl)oxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1C(F)(F)F)C(=O)N(CCO)Cc1ccccc1 |
| InChI | InChI=1S/C18H16ClF3N2O3/c19-13-6-7-15(14(10-13)18(20,21)22)23-16(26)17(27)24(8-9-25)11-12-4-2-1-3-5-12/h1-7,10,25H,8-9,11H2,(H,23,26) |
| InChIKey | SMDMWTDBXWAZQF-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.78 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|