C17H16Cl2N2O2 — CID 108500995
N'-benzyl-N-(2,5-dichlorophenyl)-N'-ethyloxamide (PubChem CID 108500995) has the molecular formula C17H16Cl2N2O2 and a molecular weight of 351.23 g/mol. Its IUPAC name is N'-benzyl-N-(2,5-dichlorophenyl)-N'-ethyloxamide.
| Compound Name | N'-benzyl-N-(2,5-dichlorophenyl)-N'-ethyloxamide |
|---|---|
| PubChem CID | 108500995 |
| Molecular Formula | C17H16Cl2N2O2 |
| Molecular Weight | 351.23 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | N'-benzyl-N-(2,5-dichlorophenyl)-N'-ethyloxamide |
| SMILES | CCN(Cc1ccccc1)C(=O)C(=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C17H16Cl2N2O2/c1-2-21(11-12-6-4-3-5-7-12)17(23)16(22)20-15-10-13(18)8-9-14(15)19/h3-10H,2,11H2,1H3,(H,20,22) |
| InChIKey | PBEIVKNPQSGUCZ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.23 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|