C17H24ClN3O3 — CID 50961889
N-[2-chloro-5-(diethylcarbamoyl)phenyl]-N',N'-diethyloxamide (PubChem CID 50961889) has the molecular formula C17H24ClN3O3 and a molecular weight of 353.85 g/mol. Its IUPAC name is N-[2-chloro-5-(diethylcarbamoyl)phenyl]-N',N'-diethyloxamide.
| Compound Name | N-[2-chloro-5-(diethylcarbamoyl)phenyl]-N',N'-diethyloxamide |
|---|---|
| PubChem CID | 50961889 |
| Molecular Formula | C17H24ClN3O3 |
| Molecular Weight | 353.85 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | N-[2-chloro-5-(diethylcarbamoyl)phenyl]-N',N'-diethyloxamide |
| SMILES | CCN(CC)C(=O)C(=O)Nc1cc(C(=O)N(CC)CC)ccc1Cl |
| InChI | InChI=1S/C17H24ClN3O3/c1-5-20(6-2)16(23)12-9-10-13(18)14(11-12)19-15(22)17(24)21(7-3)8-4/h9-11H,5-8H2,1-4H3,(H,19,22) |
| InChIKey | UHQKROPDJUNBAM-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.85 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|