C16H21ClN2O4 — CID 108986502
methyl 4-chloro-3-[[2-(dipropylamino)-2-oxoacetyl]amino]benzoate (PubChem CID 108986502) has the molecular formula C16H21ClN2O4 and a molecular weight of 340.81 g/mol. Its IUPAC name is methyl 4-chloro-3-[[2-(dipropylamino)-2-oxoacetyl]amino]benzoate.
| Compound Name | methyl 4-chloro-3-[[2-(dipropylamino)-2-oxoacetyl]amino]benzoate |
|---|---|
| PubChem CID | 108986502 |
| Molecular Formula | C16H21ClN2O4 |
| Molecular Weight | 340.81 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | methyl 4-chloro-3-[[2-(dipropylamino)-2-oxoacetyl]amino]benzoate |
| SMILES | CCCN(CCC)C(=O)C(=O)Nc1cc(C(=O)OC)ccc1Cl |
| InChI | InChI=1S/C16H21ClN2O4/c1-4-8-19(9-5-2)15(21)14(20)18-13-10-11(16(22)23-3)6-7-12(13)17/h6-7,10H,4-5,8-9H2,1-3H3,(H,18,20) |
| InChIKey | AFNBFKZKONXHEE-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.81 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|